C15H24N2O5S2 — CID 120896801
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 120896801) has the molecular formula C15H24N2O5S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 120896801 |
| Molecular Formula | C15H24N2O5S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | COCC1(CNS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)CCNCC1 |
| InChI | InChI=1S/C15H24N2O5S2/c1-22-12-15(7-9-16-10-8-15)11-17-24(20,21)14-5-3-13(4-6-14)23(2,18)19/h3-6,16-17H,7-12H2,1-2H3 |
| InChIKey | FKLWTKNLTIWKQC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |