C20H27ClN2O3S — CID 120896472
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-phenylbenzenesulfonamide;hydrochloride (PubChem CID 120896472) has the molecular formula C20H27ClN2O3S and a molecular weight of 410.97 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-phenylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-phenylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120896472 |
| Molecular Formula | C20H27ClN2O3S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-phenylbenzenesulfonamide;hydrochloride |
| SMILES | COCC1(CNS(=O)(=O)c2ccc(-c3ccccc3)cc2)CCNCC1.Cl |
| InChI | InChI=1S/C20H26N2O3S.ClH/c1-25-16-20(11-13-21-14-12-20)15-22-26(23,24)19-9-7-18(8-10-19)17-5-3-2-4-6-17;/h2-10,21-22H,11-16H2,1H3;1H |
| InChIKey | SIIXREPNBNNGNP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |