C15H25ClN2O4S — CID 120896450
2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride (PubChem CID 120896450) has the molecular formula C15H25ClN2O4S and a molecular weight of 364.90 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120896450 |
| Molecular Formula | C15H25ClN2O4S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride |
| SMILES | COCC1(CNS(=O)(=O)c2ccccc2OC)CCNCC1.Cl |
| InChI | InChI=1S/C15H24N2O4S.ClH/c1-20-12-15(7-9-16-10-8-15)11-17-22(18,19)14-6-4-3-5-13(14)21-2;/h3-6,16-17H,7-12H2,1-2H3;1H |
| InChIKey | SYIJLWGPAONVCS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |