C14H20FN3O5S — CID 120896281
3-fluoro-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-nitrobenzenesulfonamide (PubChem CID 120896281) has the molecular formula C14H20FN3O5S and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-fluoro-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-nitrobenzenesulfonamide.
| Compound Name | 3-fluoro-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120896281 |
| Molecular Formula | C14H20FN3O5S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-fluoro-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-nitrobenzenesulfonamide |
| SMILES | COCC1(CNS(=O)(=O)c2cccc(F)c2[N+](=O)[O-])CCNCC1 |
| InChI | InChI=1S/C14H20FN3O5S/c1-23-10-14(5-7-16-8-6-14)9-17-24(21,22)12-4-2-3-11(15)13(12)18(19)20/h2-4,16-17H,5-10H2,1H3 |
| InChIKey | QNXZLLXBQBAKFL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|