C15H23N3O6S — CID 120896521
3-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-nitrobenzenesulfonamide (PubChem CID 120896521) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is 3-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-nitrobenzenesulfonamide.
| Compound Name | 3-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120896521 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-4-nitrobenzenesulfonamide |
| SMILES | COCC1(CNS(=O)(=O)c2ccc([N+](=O)[O-])c(OC)c2)CCNCC1 |
| InChI | InChI=1S/C15H23N3O6S/c1-23-11-15(5-7-16-8-6-15)10-17-25(21,22)12-3-4-13(18(19)20)14(9-12)24-2/h3-4,9,16-17H,5-8,10-11H2,1-2H3 |
| InChIKey | KZVFATXAYKJXTC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|