C17H28ClFN2O5S — CID 120896300
5-fluoro-2-(2-methoxyethoxy)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride (PubChem CID 120896300) has the molecular formula C17H28ClFN2O5S and a molecular weight of 426.94 g/mol. Its IUPAC name is 5-fluoro-2-(2-methoxyethoxy)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride.
| Compound Name | 5-fluoro-2-(2-methoxyethoxy)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120896300 |
| Molecular Formula | C17H28ClFN2O5S |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 5-fluoro-2-(2-methoxyethoxy)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]benzenesulfonamide;hydrochloride |
| SMILES | COCCOc1ccc(F)cc1S(=O)(=O)NCC1(COC)CCNCC1.Cl |
| InChI | InChI=1S/C17H27FN2O5S.ClH/c1-23-9-10-25-15-4-3-14(18)11-16(15)26(21,22)20-12-17(13-24-2)5-7-19-8-6-17;/h3-4,11,19-20H,5-10,12-13H2,1-2H3;1H |
| InChIKey | VFVGRFIEDNUGGQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|