C12H20ClFN2O4S — CID 120708720
5-fluoro-2-(2-methoxyethoxy)-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120708720) has the molecular formula C12H20ClFN2O4S and a molecular weight of 342.82 g/mol. Its IUPAC name is 5-fluoro-2-(2-methoxyethoxy)-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 5-fluoro-2-(2-methoxyethoxy)-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120708720 |
| Molecular Formula | C12H20ClFN2O4S |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 5-fluoro-2-(2-methoxyethoxy)-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1cc(F)ccc1OCCOC.Cl |
| InChI | InChI=1S/C12H19FN2O4S.ClH/c1-14-5-6-15-20(16,17)12-9-10(13)3-4-11(12)19-8-7-18-2;/h3-4,9,14-15H,5-8H2,1-2H3;1H |
| InChIKey | PVBTYVDDCBSWKE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|