C14H22ClFN2O4S — CID 120713286
N-(2-amino-2-cyclopropylethyl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide;hydrochloride (PubChem CID 120713286) has the molecular formula C14H22ClFN2O4S and a molecular weight of 368.86 g/mol. Its IUPAC name is N-(2-amino-2-cyclopropylethyl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-cyclopropylethyl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120713286 |
| Molecular Formula | C14H22ClFN2O4S |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-(2-amino-2-cyclopropylethyl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide;hydrochloride |
| SMILES | COCCOc1ccc(F)cc1S(=O)(=O)NCC(N)C1CC1.Cl |
| InChI | InChI=1S/C14H21FN2O4S.ClH/c1-20-6-7-21-13-5-4-11(15)8-14(13)22(18,19)17-9-12(16)10-2-3-10;/h4-5,8,10,12,17H,2-3,6-7,9,16H2,1H3;1H |
| InChIKey | TXWKVMVSNFWVPK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|