C13H19ClN2O4S — CID 120582633
methyl 2-[(2-amino-2-cyclopropylethyl)sulfamoyl]benzoate;hydrochloride (PubChem CID 120582633) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is methyl 2-[(2-amino-2-cyclopropylethyl)sulfamoyl]benzoate;hydrochloride.
| Compound Name | methyl 2-[(2-amino-2-cyclopropylethyl)sulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120582633 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | methyl 2-[(2-amino-2-cyclopropylethyl)sulfamoyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NCC(N)C1CC1.Cl |
| InChI | InChI=1S/C13H18N2O4S.ClH/c1-19-13(16)10-4-2-3-5-12(10)20(17,18)15-8-11(14)9-6-7-9;/h2-5,9,11,15H,6-8,14H2,1H3;1H |
| InChIKey | KXADXRRXEHKMDE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |