C11H13F2NO5S — CID 103836933
methyl 2-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]benzoate (PubChem CID 103836933) has the molecular formula C11H13F2NO5S and a molecular weight of 309.29 g/mol. Its IUPAC name is methyl 2-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 103836933 |
| Molecular Formula | C11H13F2NO5S |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | methyl 2-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C11H13F2NO5S/c1-19-11(16)7-4-2-3-5-9(7)20(17,18)14-6-8(15)10(12)13/h2-5,8,10,14-15H,6H2,1H3 |
| InChIKey | ANBWFPCBTGTCCV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |