C16H26ClFN2O4S — CID 120779271
1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine;hydrochloride (PubChem CID 120779271) has the molecular formula C16H26ClFN2O4S and a molecular weight of 396.91 g/mol. Its IUPAC name is 1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120779271 |
| Molecular Formula | C16H26ClFN2O4S |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine;hydrochloride |
| SMILES | COCCOc1ccc(F)cc1S(=O)(=O)N1CCC(N)C(C)(C)C1.Cl |
| InChI | InChI=1S/C16H25FN2O4S.ClH/c1-16(2)11-19(7-6-15(16)18)24(20,21)14-10-12(17)4-5-13(14)23-9-8-22-3;/h4-5,10,15H,6-9,11,18H2,1-3H3;1H |
| InChIKey | ALECHYQMKUZPBA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|