C14H21FN2O4S — CID 120711687
[1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpyrrolidin-2-yl]methanamine (PubChem CID 120711687) has the molecular formula C14H21FN2O4S and a molecular weight of 332.40 g/mol. Its IUPAC name is [1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpyrrolidin-2-yl]methanamine.
| Compound Name | [1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 120711687 |
| Molecular Formula | C14H21FN2O4S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpyrrolidin-2-yl]methanamine |
| SMILES | COCCOc1ccc(F)cc1S(=O)(=O)N1CCCC1CN |
| InChI | InChI=1S/C14H21FN2O4S/c1-20-7-8-21-13-5-4-11(15)9-14(13)22(18,19)17-6-2-3-12(17)10-16/h4-5,9,12H,2-3,6-8,10,16H2,1H3 |
| InChIKey | NTQBIDIPOXWJFY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|