C18H27FN2O4S — CID 120711444
N-(cyclopropylmethyl)-1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-amine (PubChem CID 120711444) has the molecular formula C18H27FN2O4S and a molecular weight of 386.49 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 120711444 |
| Molecular Formula | C18H27FN2O4S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[5-fluoro-2-(2-methoxyethoxy)phenyl]sulfonylpiperidin-4-amine |
| SMILES | COCCOc1ccc(F)cc1S(=O)(=O)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C18H27FN2O4S/c1-24-10-11-25-17-5-4-15(19)12-18(17)26(22,23)21-8-6-16(7-9-21)20-13-14-2-3-14/h4-5,12,14,16,20H,2-3,6-11,13H2,1H3 |
| InChIKey | GMHAENIHDGPVAP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|