C17H23FN2O4S — CID 119987926
methyl 2-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-4-fluorobenzoate (PubChem CID 119987926) has the molecular formula C17H23FN2O4S and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl 2-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-4-fluorobenzoate.
| Compound Name | methyl 2-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-4-fluorobenzoate |
|---|---|
| PubChem CID | 119987926 |
| Molecular Formula | C17H23FN2O4S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | methyl 2-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)cc1S(=O)(=O)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C17H23FN2O4S/c1-24-17(21)15-5-4-13(18)10-16(15)25(22,23)20-8-6-14(7-9-20)19-11-12-2-3-12/h4-5,10,12,14,19H,2-3,6-9,11H2,1H3 |
| InChIKey | XPWYDUMONVPQHH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |