C17H25ClN2O4S — CID 119987530
methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzoate;hydrochloride (PubChem CID 119987530) has the molecular formula C17H25ClN2O4S and a molecular weight of 388.92 g/mol. Its IUPAC name is methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzoate;hydrochloride.
| Compound Name | methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119987530 |
| Molecular Formula | C17H25ClN2O4S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | methyl 4-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC(NCC3CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C17H24N2O4S.ClH/c1-23-17(20)14-4-6-16(7-5-14)24(21,22)19-10-8-15(9-11-19)18-12-13-2-3-13;/h4-7,13,15,18H,2-3,8-12H2,1H3;1H |
| InChIKey | BGLLCKCAFILJPA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |