C17H25N3O3S — CID 119987776
5-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-2-methylbenzamide (PubChem CID 119987776) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 5-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-2-methylbenzamide.
| Compound Name | 5-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-2-methylbenzamide |
|---|---|
| PubChem CID | 119987776 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NCC3CC3)CC2)cc1C(N)=O |
| InChI | InChI=1S/C17H25N3O3S/c1-12-2-5-15(10-16(12)17(18)21)24(22,23)20-8-6-14(7-9-20)19-11-13-3-4-13/h2,5,10,13-14,19H,3-4,6-9,11H2,1H3,(H2,18,21) |
| InChIKey | HSPPHCARLCXBSQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |