C16H26N2O4S — CID 120779581
1-[4-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine (PubChem CID 120779581) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120779581 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)phenyl]sulfonyl-3,3-dimethylpiperidin-4-amine |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCC(N)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H26N2O4S/c1-16(2)12-18(9-8-15(16)17)23(19,20)14-6-4-13(5-7-14)22-11-10-21-3/h4-7,15H,8-12,17H2,1-3H3 |
| InChIKey | QTMQOJNDOFNBIU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|