C16H23FN2O4S — CID 120707764
N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 120707764) has the molecular formula C16H23FN2O4S and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 120707764 |
| Molecular Formula | C16H23FN2O4S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-2-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | COCCOc1ccc(F)cc1S(=O)(=O)NC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C16H23FN2O4S/c1-22-6-7-23-15-5-2-11(17)8-16(15)24(20,21)19-14-9-12-3-4-13(10-14)18-12/h2,5,8,12-14,18-19H,3-4,6-7,9-10H2,1H3 |
| InChIKey | WOOUXIHQIZRMOI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|