C12H20BrClN2O4S — CID 120896062
5-bromo-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-sulfonamide;hydrochloride (PubChem CID 120896062) has the molecular formula C12H20BrClN2O4S and a molecular weight of 403.73 g/mol. Its IUPAC name is 5-bromo-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-sulfonamide;hydrochloride.
| Compound Name | 5-bromo-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120896062 |
| Molecular Formula | C12H20BrClN2O4S |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 5-bromo-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]furan-2-sulfonamide;hydrochloride |
| SMILES | COCC1(CNS(=O)(=O)c2ccc(Br)o2)CCNCC1.Cl |
| InChI | InChI=1S/C12H19BrN2O4S.ClH/c1-18-9-12(4-6-14-7-5-12)8-15-20(16,17)11-3-2-10(13)19-11;/h2-3,14-15H,4-9H2,1H3;1H |
| InChIKey | PMOVPTIEHOCFHZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |