C12H21ClN2O6S — CID 120717695
ethyl 5-[2-(2-methoxyethylamino)ethylsulfamoyl]furan-2-carboxylate;hydrochloride (PubChem CID 120717695) has the molecular formula C12H21ClN2O6S and a molecular weight of 356.83 g/mol. Its IUPAC name is ethyl 5-[2-(2-methoxyethylamino)ethylsulfamoyl]furan-2-carboxylate;hydrochloride.
| Compound Name | ethyl 5-[2-(2-methoxyethylamino)ethylsulfamoyl]furan-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120717695 |
| Molecular Formula | C12H21ClN2O6S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | ethyl 5-[2-(2-methoxyethylamino)ethylsulfamoyl]furan-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NCCNCCOC)o1.Cl |
| InChI | InChI=1S/C12H20N2O6S.ClH/c1-3-19-12(15)10-4-5-11(20-10)21(16,17)14-7-6-13-8-9-18-2;/h4-5,13-14H,3,6-9H2,1-2H3;1H |
| InChIKey | DSHOJQLMNLKKRA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|