C12H21ClN2O5S — CID 120664749
ethyl 5-[[(2R)-2-(ethylamino)propyl]sulfamoyl]furan-2-carboxylate;hydrochloride (PubChem CID 120664749) has the molecular formula C12H21ClN2O5S and a molecular weight of 340.83 g/mol. Its IUPAC name is ethyl 5-[[(2R)-2-(ethylamino)propyl]sulfamoyl]furan-2-carboxylate;hydrochloride.
| Compound Name | ethyl 5-[[(2R)-2-(ethylamino)propyl]sulfamoyl]furan-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120664749 |
| Molecular Formula | C12H21ClN2O5S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | ethyl 5-[[(2R)-2-(ethylamino)propyl]sulfamoyl]furan-2-carboxylate;hydrochloride |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1ccc(C(=O)OCC)o1.Cl |
| InChI | InChI=1S/C12H20N2O5S.ClH/c1-4-13-9(3)8-14-20(16,17)11-7-6-10(19-11)12(15)18-5-2;/h6-7,9,13-14H,4-5,8H2,1-3H3;1H/t9-;/m1./s1 |
| InChIKey | BSEVYOCLYZJAEF-SBSPUUFOSA-N |
| XLogP | 1.15 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |