C14H22ClFN2O4S — CID 120664775
ethyl 3-[[(2R)-2-(ethylamino)propyl]sulfamoyl]-5-fluorobenzoate;hydrochloride (PubChem CID 120664775) has the molecular formula C14H22ClFN2O4S and a molecular weight of 368.86 g/mol. Its IUPAC name is ethyl 3-[[(2R)-2-(ethylamino)propyl]sulfamoyl]-5-fluorobenzoate;hydrochloride.
| Compound Name | ethyl 3-[[(2R)-2-(ethylamino)propyl]sulfamoyl]-5-fluorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 120664775 |
| Molecular Formula | C14H22ClFN2O4S |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl 3-[[(2R)-2-(ethylamino)propyl]sulfamoyl]-5-fluorobenzoate;hydrochloride |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1cc(F)cc(C(=O)OCC)c1.Cl |
| InChI | InChI=1S/C14H21FN2O4S.ClH/c1-4-16-10(3)9-17-22(19,20)13-7-11(6-12(15)8-13)14(18)21-5-2;/h6-8,10,16-17H,4-5,9H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | HYBMDUBMWXONOF-HNCPQSOCSA-N |
| XLogP | 1.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |