C11H15F3N2O2S — CID 120664616
N-[(2R)-2-(ethylamino)propyl]-2,4,5-trifluorobenzenesulfonamide (PubChem CID 120664616) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2,4,5-trifluorobenzenesulfonamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2,4,5-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 120664616 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2,4,5-trifluorobenzenesulfonamide |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H15F3N2O2S/c1-3-15-7(2)6-16-19(17,18)11-5-9(13)8(12)4-10(11)14/h4-5,7,15-16H,3,6H2,1-2H3/t7-/m1/s1 |
| InChIKey | GNARRLFCFOPGSA-SSDOTTSWSA-N |
| XLogP | 1.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|