C11H16F2N2O2S — CID 120664782
N-[(2R)-2-(ethylamino)propyl]-2,4-difluorobenzenesulfonamide (PubChem CID 120664782) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 120664782 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H16F2N2O2S/c1-3-14-8(2)7-15-18(16,17)11-5-4-9(12)6-10(11)13/h4-6,8,14-15H,3,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | RJNQZEPRVNPPCS-MRVPVSSYSA-N |
| XLogP | 1.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |