C12H16FN3O2S — CID 120664948
3-cyano-N-[(2R)-2-(ethylamino)propyl]-4-fluorobenzenesulfonamide (PubChem CID 120664948) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-cyano-N-[(2R)-2-(ethylamino)propyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-cyano-N-[(2R)-2-(ethylamino)propyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 120664948 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-cyano-N-[(2R)-2-(ethylamino)propyl]-4-fluorobenzenesulfonamide |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C12H16FN3O2S/c1-3-15-9(2)8-16-19(17,18)11-4-5-12(13)10(6-11)7-14/h4-6,9,15-16H,3,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | OQYQGGXERHGQQN-SECBINFHSA-N |
| XLogP | 0.97 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |