C11H13FN2O3S — CID 113318233
3-cyano-4-fluoro-N-(4-hydroxybutan-2-yl)benzenesulfonamide (PubChem CID 113318233) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-(4-hydroxybutan-2-yl)benzenesulfonamide.
| Compound Name | 3-cyano-4-fluoro-N-(4-hydroxybutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113318233 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-cyano-4-fluoro-N-(4-hydroxybutan-2-yl)benzenesulfonamide |
| SMILES | CC(CCO)NS(=O)(=O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C11H13FN2O3S/c1-8(4-5-15)14-18(16,17)10-2-3-11(12)9(6-10)7-13/h2-3,6,8,14-15H,4-5H2,1H3 |
| InChIKey | JRQOKXLDXOMKOU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |