C11H15N3O3S — CID 83176394
4-amino-2-cyano-N-(4-hydroxybutan-2-yl)benzenesulfonamide (PubChem CID 83176394) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-amino-2-cyano-N-(4-hydroxybutan-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-cyano-N-(4-hydroxybutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 83176394 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-amino-2-cyano-N-(4-hydroxybutan-2-yl)benzenesulfonamide |
| SMILES | CC(CCO)NS(=O)(=O)c1ccc(N)cc1C#N |
| InChI | InChI=1S/C11H15N3O3S/c1-8(4-5-15)14-18(16,17)11-3-2-10(13)6-9(11)7-12/h2-3,6,8,14-15H,4-5,13H2,1H3 |
| InChIKey | JHQVQINPNKHZRC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|