C10H13N3O3S — CID 93081252
4-amino-2-cyano-N-[(2R)-2-hydroxypropyl]benzenesulfonamide (PubChem CID 93081252) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-amino-2-cyano-N-[(2R)-2-hydroxypropyl]benzenesulfonamide.
| Compound Name | 4-amino-2-cyano-N-[(2R)-2-hydroxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 93081252 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-amino-2-cyano-N-[(2R)-2-hydroxypropyl]benzenesulfonamide |
| SMILES | C[C@@H](O)CNS(=O)(=O)c1ccc(N)cc1C#N |
| InChI | InChI=1S/C10H13N3O3S/c1-7(14)6-13-17(15,16)10-3-2-9(12)4-8(10)5-11/h2-4,7,13-14H,6,12H2,1H3/t7-/m1/s1 |
| InChIKey | VICPCDJHGQDVLQ-SSDOTTSWSA-N |
| XLogP | -0.20 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|