C10H12N4O4S — CID 106164933
3-[(4-amino-2-cyanophenyl)sulfonylamino]-2-hydroxypropanamide (PubChem CID 106164933) has the molecular formula C10H12N4O4S and a molecular weight of 284.30 g/mol. Its IUPAC name is 3-[(4-amino-2-cyanophenyl)sulfonylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(4-amino-2-cyanophenyl)sulfonylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106164933 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-[(4-amino-2-cyanophenyl)sulfonylamino]-2-hydroxypropanamide |
| SMILES | N#Cc1cc(N)ccc1S(=O)(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C10H12N4O4S/c11-4-6-3-7(12)1-2-9(6)19(17,18)14-5-8(15)10(13)16/h1-3,8,14-15H,5,12H2,(H2,13,16) |
| InChIKey | UHIXUJKSNDPITI-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 159.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|