C12H13FN2O4S2 — CID 63287865
2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 63287865) has the molecular formula C12H13FN2O4S2 and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 63287865 |
| Molecular Formula | C12H13FN2O4S2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(F)c(C#N)c1)C(=O)O |
| InChI | InChI=1S/C12H13FN2O4S2/c1-20-5-4-11(12(16)17)15-21(18,19)9-2-3-10(13)8(6-9)7-14/h2-3,6,11,15H,4-5H2,1H3,(H,16,17) |
| InChIKey | SKHCQSROAPKCEQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |