C11H10FN3O5S — CID 104935170
(2R)-4-amino-2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-oxobutanoic acid (PubChem CID 104935170) has the molecular formula C11H10FN3O5S and a molecular weight of 315.28 g/mol. Its IUPAC name is (2R)-4-amino-2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 104935170 |
| Molecular Formula | C11H10FN3O5S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (2R)-4-amino-2-[(3-cyano-4-fluorophenyl)sulfonylamino]-4-oxobutanoic acid |
| SMILES | N#Cc1cc(S(=O)(=O)N[C@H](CC(N)=O)C(=O)O)ccc1F |
| InChI | InChI=1S/C11H10FN3O5S/c12-8-2-1-7(3-6(8)5-13)21(19,20)15-9(11(17)18)4-10(14)16/h1-3,9,15H,4H2,(H2,14,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | RGKTYXCCZLQRAO-SECBINFHSA-N |
| XLogP | -0.70 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |