C12H14N2O6S — CID 28538089
(2R)-2-[(3-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid (PubChem CID 28538089) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is (2R)-2-[(3-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid.
| Compound Name | (2R)-2-[(3-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 28538089 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2R)-2-[(3-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N[C@H](CC(N)=O)C(=O)O)c1 |
| InChI | InChI=1S/C12H14N2O6S/c1-7(15)8-3-2-4-9(5-8)21(19,20)14-10(12(17)18)6-11(13)16/h2-5,10,14H,6H2,1H3,(H2,13,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | OEXWAECXFKHOFE-SNVBAGLBSA-N |
| XLogP | -0.50 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |