C12H11Br3N2O6S — CID 18717057
4-amino-4-oxo-2-[[3-(tribromomethylsulfonyl)benzoyl]amino]butanoic acid (PubChem CID 18717057) has the molecular formula C12H11Br3N2O6S and a molecular weight of 551.01 g/mol. Its IUPAC name is 4-amino-4-oxo-2-[[3-(tribromomethylsulfonyl)benzoyl]amino]butanoic acid.
| Compound Name | 4-amino-4-oxo-2-[[3-(tribromomethylsulfonyl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 18717057 |
| Molecular Formula | C12H11Br3N2O6S |
| Molecular Weight | 551.01 g/mol |
| Exact Mass | 547.79 |
| IUPAC Name | 4-amino-4-oxo-2-[[3-(tribromomethylsulfonyl)benzoyl]amino]butanoic acid |
| SMILES | NC(=O)CC(NC(=O)c1cccc(S(=O)(=O)C(Br)(Br)Br)c1)C(=O)O |
| InChI | InChI=1S/C12H11Br3N2O6S/c13-12(14,15)24(22,23)7-3-1-2-6(4-7)10(19)17-8(11(20)21)5-9(16)18/h1-4,8H,5H2,(H2,16,18)(H,17,19)(H,20,21) |
| InChIKey | FLEZTTWVHCIYQE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.01 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|