C11H10ClIN2O4 — CID 114004761
(2R)-4-amino-2-[(3-chloro-4-iodobenzoyl)amino]-4-oxobutanoic acid (PubChem CID 114004761) has the molecular formula C11H10ClIN2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is (2R)-4-amino-2-[(3-chloro-4-iodobenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[(3-chloro-4-iodobenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 114004761 |
| Molecular Formula | C11H10ClIN2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | (2R)-4-amino-2-[(3-chloro-4-iodobenzoyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)c1ccc(I)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H10ClIN2O4/c12-6-3-5(1-2-7(6)13)10(17)15-8(11(18)19)4-9(14)16/h1-3,8H,4H2,(H2,14,16)(H,15,17)(H,18,19)/t8-/m1/s1 |
| InChIKey | SNSLPTCNJHINPY-MRVPVSSYSA-N |
| XLogP | 1.00 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|