C12H12ClIN2O5 — CID 43357181
4-amino-2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-4-oxobutanoic acid (PubChem CID 43357181) has the molecular formula C12H12ClIN2O5 and a molecular weight of 426.59 g/mol. Its IUPAC name is 4-amino-2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43357181 |
| Molecular Formula | C12H12ClIN2O5 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | 4-amino-2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-4-oxobutanoic acid |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H12ClIN2O5/c1-21-9-3-7(14)6(13)2-5(9)11(18)16-8(12(19)20)4-10(15)17/h2-3,8H,4H2,1H3,(H2,15,17)(H,16,18)(H,19,20) |
| InChIKey | JKNMCLBYLDYTTR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|