C13H15ClINO5 — CID 103153008
4-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-3-methoxybutanoic acid (PubChem CID 103153008) has the molecular formula C13H15ClINO5 and a molecular weight of 427.62 g/mol. Its IUPAC name is 4-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153008 |
| Molecular Formula | C13H15ClINO5 |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 4-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]-3-methoxybutanoic acid |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NCC(CC(=O)O)OC |
| InChI | InChI=1S/C13H15ClINO5/c1-20-7(3-12(17)18)6-16-13(19)8-4-9(14)10(15)5-11(8)21-2/h4-5,7H,3,6H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | IJHZZEFSDZOIIS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|