C13H15ClINO4 — CID 56546801
propan-2-yl 2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]acetate (PubChem CID 56546801) has the molecular formula C13H15ClINO4 and a molecular weight of 411.62 g/mol. Its IUPAC name is propan-2-yl 2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]acetate.
| Compound Name | propan-2-yl 2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 56546801 |
| Molecular Formula | C13H15ClINO4 |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | propan-2-yl 2-[(5-chloro-4-iodo-2-methoxybenzoyl)amino]acetate |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NCC(=O)OC(C)C |
| InChI | InChI=1S/C13H15ClINO4/c1-7(2)20-12(17)6-16-13(18)8-4-9(14)10(15)5-11(8)19-3/h4-5,7H,6H2,1-3H3,(H,16,18) |
| InChIKey | RAIUWKJRTYPLRZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|