C14H19ClINO3 — CID 106181558
5-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-iodo-2-methoxybenzamide (PubChem CID 106181558) has the molecular formula C14H19ClINO3 and a molecular weight of 411.67 g/mol. Its IUPAC name is 5-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-iodo-2-methoxybenzamide.
| Compound Name | 5-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-iodo-2-methoxybenzamide |
|---|---|
| PubChem CID | 106181558 |
| Molecular Formula | C14H19ClINO3 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 5-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-4-iodo-2-methoxybenzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C14H19ClINO3/c1-13(2,14(3,4)19)17-12(18)8-6-9(15)10(16)7-11(8)20-5/h6-7,19H,1-5H3,(H,17,18) |
| InChIKey | WNQCKBMSEVZSLD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|