C10H11ClINO3 — CID 43419592
5-chloro-N-(2-hydroxyethyl)-4-iodo-2-methoxybenzamide (PubChem CID 43419592) has the molecular formula C10H11ClINO3 and a molecular weight of 355.56 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxyethyl)-4-iodo-2-methoxybenzamide.
| Compound Name | 5-chloro-N-(2-hydroxyethyl)-4-iodo-2-methoxybenzamide |
|---|---|
| PubChem CID | 43419592 |
| Molecular Formula | C10H11ClINO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 5-chloro-N-(2-hydroxyethyl)-4-iodo-2-methoxybenzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NCCO |
| InChI | InChI=1S/C10H11ClINO3/c1-16-9-5-8(12)7(11)4-6(9)10(15)13-2-3-14/h4-5,14H,2-3H2,1H3,(H,13,15) |
| InChIKey | WAZWJUWHWJXRQH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|