C13H17ClINO4 — CID 103877149
5-chloro-N-(3-hydroxy-4-methoxybutyl)-4-iodo-2-methoxybenzamide (PubChem CID 103877149) has the molecular formula C13H17ClINO4 and a molecular weight of 413.64 g/mol. Its IUPAC name is 5-chloro-N-(3-hydroxy-4-methoxybutyl)-4-iodo-2-methoxybenzamide.
| Compound Name | 5-chloro-N-(3-hydroxy-4-methoxybutyl)-4-iodo-2-methoxybenzamide |
|---|---|
| PubChem CID | 103877149 |
| Molecular Formula | C13H17ClINO4 |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 5-chloro-N-(3-hydroxy-4-methoxybutyl)-4-iodo-2-methoxybenzamide |
| SMILES | COCC(O)CCNC(=O)c1cc(Cl)c(I)cc1OC |
| InChI | InChI=1S/C13H17ClINO4/c1-19-7-8(17)3-4-16-13(18)9-5-10(14)11(15)6-12(9)20-2/h5-6,8,17H,3-4,7H2,1-2H3,(H,16,18) |
| InChIKey | ZCNVGTDNJCPGRJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|