C18H19ClINO5 — CID 55606907
5-chloro-4-iodo-2-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 55606907) has the molecular formula C18H19ClINO5 and a molecular weight of 491.71 g/mol. Its IUPAC name is 5-chloro-4-iodo-2-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 5-chloro-4-iodo-2-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55606907 |
| Molecular Formula | C18H19ClINO5 |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 5-chloro-4-iodo-2-methoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H19ClINO5/c1-23-14-8-13(20)12(19)7-11(14)18(22)21-9-10-5-15(24-2)17(26-4)16(6-10)25-3/h5-8H,9H2,1-4H3,(H,21,22) |
| InChIKey | ODFVWRONCYDHBN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|