C15H20ClIN2O3 — CID 55947023
N-[3-(butan-2-ylamino)-3-oxopropyl]-5-chloro-4-iodo-2-methoxybenzamide (PubChem CID 55947023) has the molecular formula C15H20ClIN2O3 and a molecular weight of 438.69 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-5-chloro-4-iodo-2-methoxybenzamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-5-chloro-4-iodo-2-methoxybenzamide |
|---|---|
| PubChem CID | 55947023 |
| Molecular Formula | C15H20ClIN2O3 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-5-chloro-4-iodo-2-methoxybenzamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)c1cc(Cl)c(I)cc1OC |
| InChI | InChI=1S/C15H20ClIN2O3/c1-4-9(2)19-14(20)5-6-18-15(21)10-7-11(16)12(17)8-13(10)22-3/h7-9H,4-6H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | GQWQBCHQLXLNBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|