C13H17ClINO3 — CID 79253137
5-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-iodo-2-methoxybenzamide (PubChem CID 79253137) has the molecular formula C13H17ClINO3 and a molecular weight of 397.64 g/mol. Its IUPAC name is 5-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-iodo-2-methoxybenzamide.
| Compound Name | 5-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-iodo-2-methoxybenzamide |
|---|---|
| PubChem CID | 79253137 |
| Molecular Formula | C13H17ClINO3 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 5-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-iodo-2-methoxybenzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NC(CO)C(C)C |
| InChI | InChI=1S/C13H17ClINO3/c1-7(2)11(6-17)16-13(18)8-4-9(14)10(15)5-12(8)19-3/h4-5,7,11,17H,6H2,1-3H3,(H,16,18) |
| InChIKey | RYQZRHLAIFVYSW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|