C17H17ClINO4S — CID 55607362
5-chloro-4-iodo-2-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide (PubChem CID 55607362) has the molecular formula C17H17ClINO4S and a molecular weight of 493.75 g/mol. Its IUPAC name is 5-chloro-4-iodo-2-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 5-chloro-4-iodo-2-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55607362 |
| Molecular Formula | C17H17ClINO4S |
| Molecular Weight | 493.75 g/mol |
| Exact Mass | 492.96 |
| IUPAC Name | 5-chloro-4-iodo-2-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NC(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17ClINO4S/c1-10(11-4-6-12(7-5-11)25(3,22)23)20-17(21)13-8-14(18)15(19)9-16(13)24-2/h4-10H,1-3H3,(H,20,21) |
| InChIKey | IXZNWWJMFJVSPS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|