C21H27NO4S — CID 133165871
4-methoxy-2-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylbenzamide (PubChem CID 133165871) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylbenzamide.
| Compound Name | 4-methoxy-2-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133165871 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-methoxy-2-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylbenzamide |
| SMILES | COc1cc(C)c(C(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)cc1C(C)C |
| InChI | InChI=1S/C21H27NO4S/c1-13(2)18-12-19(14(3)11-20(18)26-5)21(23)22-15(4)16-7-9-17(10-8-16)27(6,24)25/h7-13,15H,1-6H3,(H,22,23) |
| InChIKey | VXYOCWXPONASEU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |