C24H25NO5S — CID 55433266
3-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]-4-phenylmethoxybenzamide (PubChem CID 55433266) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is 3-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]-4-phenylmethoxybenzamide.
| Compound Name | 3-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 55433266 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 3-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25NO5S/c1-17(19-9-12-21(13-10-19)31(3,27)28)25-24(26)20-11-14-22(23(15-20)29-2)30-16-18-7-5-4-6-8-18/h4-15,17H,16H2,1-3H3,(H,25,26) |
| InChIKey | LFFGAAREWGEWFX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |