C18H21NO5S — CID 18096228
2-(2-methoxyphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 18096228) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18096228 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)NC(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-13(14-8-10-15(11-9-14)25(3,21)22)19-18(20)12-24-17-7-5-4-6-16(17)23-2/h4-11,13H,12H2,1-3H3,(H,19,20) |
| InChIKey | FPEUVNFOLHXIOR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |