C21H21NO4S — CID 26468178
N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 26468178) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 26468178 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | C[C@@H](NC(=O)COc1ccc2ccccc2c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-15(16-8-11-20(12-9-16)27(2,24)25)22-21(23)14-26-19-10-7-17-5-3-4-6-18(17)13-19/h3-13,15H,14H2,1-2H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | WGZJGZRTFTVNRR-OAHLLOKOSA-N |
| XLogP | 3.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |