C20H18ClNO2 — CID 42989419
N-[1-(4-chlorophenyl)ethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 42989419) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 42989419 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | CC(NC(=O)COc1ccc2ccccc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO2/c1-14(15-6-9-18(21)10-7-15)22-20(23)13-24-19-11-8-16-4-2-3-5-17(16)12-19/h2-12,14H,13H2,1H3,(H,22,23) |
| InChIKey | GOINHJCBHAFRRB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |