C14H20ClIN2O3 — CID 103839551
5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-iodo-2-methoxybenzamide (PubChem CID 103839551) has the molecular formula C14H20ClIN2O3 and a molecular weight of 426.68 g/mol. Its IUPAC name is 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-iodo-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-iodo-2-methoxybenzamide |
|---|---|
| PubChem CID | 103839551 |
| Molecular Formula | C14H20ClIN2O3 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-iodo-2-methoxybenzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NCC(C)(O)CN(C)C |
| InChI | InChI=1S/C14H20ClIN2O3/c1-14(20,8-18(2)3)7-17-13(19)9-5-10(15)11(16)6-12(9)21-4/h5-6,20H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | FJJFHAXZNGFZEU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|